
CAS 946759-48-4
:3-(2-Methoxy-5-nitrophenoxy)piperidine
Description:
3-(2-Methoxy-5-nitrophenoxy)piperidine is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. This compound features a methoxy group and a nitrophenyl moiety, contributing to its unique chemical properties. The presence of the nitro group typically enhances the compound's reactivity and can influence its biological activity, making it of interest in medicinal chemistry. The methoxy group can affect solubility and lipophilicity, which are important for pharmacokinetics. Additionally, the compound's structure suggests potential interactions with biological targets, possibly leading to applications in drug development. Its molecular structure can be analyzed using techniques such as NMR and mass spectrometry, which help confirm its identity and purity. Overall, 3-(2-Methoxy-5-nitrophenoxy)piperidine is a compound of interest due to its functional groups and potential applications in various fields, including pharmaceuticals and organic synthesis.
Formula:C12H16N2O4
InChI:InChI=1S/C12H16N2O4/c1-17-11-5-4-9(14(15)16)7-12(11)18-10-3-2-6-13-8-10/h4-5,7,10,13H,2-3,6,8H2,1H3
InChI key:InChIKey=QEBKZQAKWIAEHV-UHFFFAOYSA-N
SMILES:O(C1=C(OC)C=CC(N(=O)=O)=C1)C2CCCNC2
Synonyms:- 3-(2-Methoxy-5-nitrophenoxy)piperidine
- Piperidine, 3-(2-methoxy-5-nitrophenoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.