CAS 946759-56-4
:3-(4-Fluoro-2-methylphenoxy)piperidine
Description:
3-(4-Fluoro-2-methylphenoxy)piperidine is a chemical compound characterized by its piperidine core, which is a six-membered ring containing five carbon atoms and one nitrogen atom. The compound features a phenoxy group, specifically a 4-fluoro-2-methylphenyl moiety, indicating the presence of a fluorine atom and a methyl group on the aromatic ring. This substitution pattern can influence the compound's physical and chemical properties, such as solubility, reactivity, and biological activity. The presence of the piperidine ring suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as piperidine derivatives are often associated with various biological activities. The compound's molecular structure may also exhibit specific interactions with biological targets, making it of interest in drug discovery. Additionally, the fluorine atom can enhance metabolic stability and lipophilicity, which are desirable traits in drug design. Overall, 3-(4-Fluoro-2-methylphenoxy)piperidine is a compound with unique structural features that may contribute to its potential applications in various fields, including medicinal chemistry and material science.
Formula:C12H16FNO
InChI:InChI=1S/C12H16FNO/c1-9-7-10(13)4-5-12(9)15-11-3-2-6-14-8-11/h4-5,7,11,14H,2-3,6,8H2,1H3
InChI key:InChIKey=ISAZERLJHRRHKE-UHFFFAOYSA-N
SMILES:O(C1=C(C)C=C(F)C=C1)C2CCCNC2
Synonyms:- Piperidine, 3-(4-fluoro-2-methylphenoxy)-
- 3-(4-Fluoro-2-methylphenoxy)piperidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.