CAS 946768-76-9
:N-(3-amino-2-methylphenyl)-2-methylbutanamide
Description:
N-(3-amino-2-methylphenyl)-2-methylbutanamide, identified by its CAS number 946768-76-9, is an organic compound characterized by its amide functional group, which is formed from the reaction of an amine and a carboxylic acid. This compound features a 2-methylbutanamide backbone, indicating the presence of a branched alkyl chain, which contributes to its hydrophobic characteristics. The presence of the amino group on the aromatic ring enhances its potential for hydrogen bonding, influencing its solubility and reactivity. The specific arrangement of the methyl and amino substituents on the phenyl ring suggests that it may exhibit unique steric and electronic properties, potentially affecting its biological activity. Such compounds are often of interest in medicinal chemistry and drug development due to their ability to interact with biological targets. Overall, N-(3-amino-2-methylphenyl)-2-methylbutanamide is a complex molecule with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C12H18N2O
InChI:InChI=1/C12H18N2O/c1-4-8(2)12(15)14-11-7-5-6-10(13)9(11)3/h5-8H,4,13H2,1-3H3,(H,14,15)
SMILES:CCC(C)C(=Nc1cccc(c1C)N)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.