CymitQuimica logo

CAS 946769-29-5

:

N-(3-amino-4-methyl-phenyl)butanamide

Description:
N-(3-amino-4-methyl-phenyl)butanamide, identified by its CAS number 946769-29-5, is an organic compound characterized by its amide functional group and an aromatic ring. This substance features a butanamide backbone, which contributes to its potential as a building block in pharmaceutical synthesis or as a ligand in coordination chemistry. The presence of the amino group and the methyl-substituted phenyl ring suggests that it may exhibit interesting biological activity, possibly interacting with various biological targets. The compound's solubility, stability, and reactivity can be influenced by its molecular structure, including the steric and electronic effects of the amino and methyl groups. Additionally, the compound's properties may be further characterized by its melting point, boiling point, and spectral data, which can provide insights into its purity and structural integrity. Overall, N-(3-amino-4-methyl-phenyl)butanamide represents a versatile compound with potential applications in medicinal chemistry and related fields.
Formula:C11H16N2O
InChI:InChI=1/C11H16N2O/c1-3-4-11(14)13-9-6-5-8(2)10(12)7-9/h5-7H,3-4,12H2,1-2H3,(H,13,14)
SMILES:CCCC(=Nc1ccc(C)c(c1)N)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.