CAS 946769-33-1
:N-(3-Amino-4-methylphenyl)-3-methylbutanamide
Description:
N-(3-Amino-4-methylphenyl)-3-methylbutanamide, identified by its CAS number 946769-33-1, is an organic compound characterized by its amide functional group, which is formed from the reaction of an amine and a carboxylic acid. This compound features a 3-amino-4-methylphenyl group, indicating the presence of an amino group (-NH2) and a methyl group (-CH3) on a phenyl ring, contributing to its aromatic properties. The 3-methylbutanamide portion of the molecule suggests a branched aliphatic structure, which can influence its physical properties such as solubility and boiling point. The presence of both aromatic and aliphatic components may also affect its reactivity and interactions with biological systems, making it of interest in pharmaceutical and medicinal chemistry. Additionally, the compound's specific stereochemistry and functional groups can play a significant role in its biological activity and potential applications. Overall, N-(3-Amino-4-methylphenyl)-3-methylbutanamide is a compound that may exhibit unique characteristics due to its structural features.
Formula:C12H18N2O
InChI:InChI=1S/C12H18N2O/c1-8(2)6-12(15)14-10-5-4-9(3)11(13)7-10/h4-5,7-8H,6,13H2,1-3H3,(H,14,15)
InChI key:InChIKey=BKALDVATHWWULE-UHFFFAOYSA-N
SMILES:N(C(CC(C)C)=O)C1=CC(N)=C(C)C=C1
Synonyms:- N-(3-Amino-4-methylphenyl)-3-methylbutanamide
- Butanamide, N-(3-amino-4-methylphenyl)-3-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.