CAS 946769-41-1
:N-(3-amino-4-methyl-phenyl)-2-methoxy-acetamide
Description:
N-(3-amino-4-methyl-phenyl)-2-methoxy-acetamide, identified by its CAS number 946769-41-1, is an organic compound characterized by its amide functional group, which is indicative of its potential biological activity. The presence of an amino group and a methoxy group suggests that this compound may exhibit polar characteristics, influencing its solubility in various solvents. The aromatic ring, specifically the 4-methyl substitution, contributes to its stability and may affect its interaction with biological targets. This compound is likely to be of interest in medicinal chemistry, potentially serving as a lead compound for drug development due to its structural features that may interact with specific biological pathways. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties could be further explored through various analytical methods such as NMR, IR spectroscopy, and mass spectrometry. Overall, the unique combination of functional groups in N-(3-amino-4-methyl-phenyl)-2-methoxy-acetamide suggests a versatile compound with potential applications in pharmaceuticals or biochemistry.
Formula:C10H14N2O2
InChI:InChI=1/C10H14N2O2/c1-7-3-4-8(5-9(7)11)12-10(13)6-14-2/h3-5H,6,11H2,1-2H3,(H,12,13)
SMILES:Cc1ccc(cc1N)N=C(COC)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
