CymitQuimica logo

CAS 946774-05-6

:

2-[2-(2-Methoxyethoxy)ethoxy]-4-methylbenzenamine

Description:
2-[2-(2-Methoxyethoxy)ethoxy]-4-methylbenzenamine, with the CAS number 946774-05-6, is an organic compound characterized by its complex structure that includes an aromatic amine and ether functionalities. This compound features a methyl group attached to a benzene ring, which contributes to its hydrophobic characteristics, while the methoxyethoxy groups enhance its solubility in polar solvents. The presence of the amino group (-NH2) indicates that it can participate in hydrogen bonding, making it potentially reactive in various chemical reactions, including nucleophilic substitutions. Its molecular structure suggests that it may exhibit properties such as moderate volatility and stability under standard conditions. Additionally, the compound may have applications in fields such as pharmaceuticals, agrochemicals, or materials science, depending on its specific reactivity and interactions with other substances. Safety data and handling precautions should be consulted, as with any chemical, to ensure proper use and minimize risks associated with exposure.
Formula:C12H19NO3
InChI:InChI=1S/C12H19NO3/c1-10-3-4-11(13)12(9-10)16-8-7-15-6-5-14-2/h3-4,9H,5-8,13H2,1-2H3
InChI key:InChIKey=CBTFDOJVTPICGL-UHFFFAOYSA-N
SMILES:O(CCOCCOC)C1=C(N)C=CC(C)=C1
Synonyms:
  • Benzenamine, 2-[2-(2-methoxyethoxy)ethoxy]-4-methyl-
  • 2-[2-(2-Methoxyethoxy)ethoxy]-4-methylbenzenamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.