CAS 946774-13-6

Benzenamine, 4-methyl-2-[2-(1-piperidinyl)ethoxy]-

Description:

Benzenamine, 4-methyl-2-[2-(1-piperidinyl)ethoxy]- is an organic compound characterized by its aromatic amine structure, which includes a benzene ring substituted with a methyl group and an ethoxy group linked to a piperidine moiety. This compound features a piperidine ring, a six-membered nitrogen-containing heterocycle, which contributes to its potential biological activity. The presence of the ethoxy group enhances its solubility in organic solvents, while the amine functionality can participate in hydrogen bonding and other interactions, making it relevant in medicinal chemistry. The compound may exhibit properties such as being a potential ligand for various biological targets, and its structure suggests it could be investigated for pharmacological applications. Additionally, due to the presence of both hydrophobic and hydrophilic regions, it may demonstrate interesting lipophilicity and permeability characteristics. Safety and handling precautions should be observed, as with many amines, due to potential toxicity and reactivity.

Formula: C₁₄H₂₂N₂O

InChI: InChI=1S/C14H22N2O/c1-12-5-6-13(15)14(11-12)17-10-9-16-7-3-2-4-8-16/h5-6,11H,2-4,7-10,15H2,1H3

InChI key: InChIKey=XHUKOJBMLBCSLY-UHFFFAOYSA-N

SMILES: O(CCN1CCCCC1)C2=C(N)C=CC(C)=C2

Synonyms:

• Benzenamine, 4-methyl-2-[2-(1-piperidinyl)ethoxy]-