CAS 946774-84-1

N-[2-(2-Amino-4-fluorophenoxy)ethyl]-N-methylbenzenamine

Description:

N-[2-(2-Amino-4-fluorophenoxy)ethyl]-N-methylbenzenamine, identified by its CAS number 946774-84-1, is a chemical compound characterized by its complex structure, which includes an amine group, a fluorinated aromatic ring, and an ether linkage. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility and reactivity. The presence of the fluorine atom may enhance its lipophilicity and alter its electronic properties, potentially affecting its biological activity. The compound's molecular structure suggests it may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can interact with biological targets. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including purification methods such as chromatography. Overall, this compound's unique features make it a subject of interest for further research in various chemical and biological applications.

Formula: C₁₅H₁₇FN₂O

InChI: InChI=1S/C15H17FN2O/c1-18(13-5-3-2-4-6-13)9-10-19-15-8-7-12(16)11-14(15)17/h2-8,11H,9-10,17H2,1H3

InChI key: InChIKey=KCYIYFRHIRJVQW-UHFFFAOYSA-N

SMILES: O(CCN(C)C1=CC=CC=C1)C2=C(N)C=C(F)C=C2

Synonyms:

• N-[2-(2-Amino-4-fluorophenoxy)ethyl]-N-methylbenzenamine
• Benzenamine, N-[2-(2-amino-4-fluorophenoxy)ethyl]-N-methyl-