CAS 94678-45-2
:1,3,5-tris(3-pyridyl)pentane-1,5-dione
Description:
1,3,5-Tris(3-pyridyl)pentane-1,5-dione, with the CAS number 94678-45-2, is an organic compound characterized by its complex structure featuring three pyridyl groups attached to a pentane backbone that contains two ketone functional groups. This compound typically exhibits properties associated with both coordination chemistry and organic synthesis, making it of interest in various chemical applications. The presence of the pyridyl groups suggests potential for coordination with metal ions, which can lead to the formation of metal-organic frameworks or catalysts. Additionally, the diketone functionality may participate in various chemical reactions, including condensation and oxidation processes. The compound is likely to be soluble in polar organic solvents due to the presence of the nitrogen-containing pyridyl groups, which can engage in hydrogen bonding. Its unique structure and functional groups may also impart interesting electronic and optical properties, making it a candidate for research in materials science and medicinal chemistry. Overall, 1,3,5-tris(3-pyridyl)pentane-1,5-dione is a versatile compound with potential applications in various fields of chemistry.
Formula:C20H17N3O2
InChI:InChI=1/C20H17N3O2/c24-19(16-5-2-8-22-13-16)10-18(15-4-1-7-21-12-15)11-20(25)17-6-3-9-23-14-17/h1-9,12-14,18H,10-11H2
SMILES:c1cc(cnc1)C(CC(=O)c1cccnc1)CC(=O)c1cccnc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,3,5-Tri(3-pyridyl)-1,5-pentanoate
CAS:Controlled ProductApplications It is used as scintillation solutes.
References Kisaki, T., et al.: Phytochemistry, 7, 323 (1968), Dwoskin, L., et al.: Eur. J. Pharma., 276, 195 (1995),Formula:C20H17N3O2Color and Shape:NeatMolecular weight:331.37
