CAS 946782-98-5
:N-(3-amino-2-methylphenyl)-N~2~,N~2~-dimethylglycinamide
Description:
N-(3-amino-2-methylphenyl)-N',N'-dimethylglycinamide, identified by its CAS number 946782-98-5, is a synthetic organic compound characterized by its amine and amide functional groups. This compound features a phenyl ring substituted with an amino group and a methyl group, contributing to its unique chemical properties. The presence of the dimethylglycinamide moiety indicates that it has potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Its structure suggests it may exhibit biological activity, possibly interacting with various biological targets due to the amino and amide functionalities. The compound's solubility, stability, and reactivity can be influenced by the presence of these functional groups, making it a subject of interest in research related to drug design and development. Additionally, its molecular interactions may be explored in the context of enzyme inhibition or receptor binding, which are critical for understanding its potential therapeutic effects. Overall, this compound represents a class of molecules that could be valuable in various chemical and biological applications.
Formula:C11H17N3O
InChI:InChI=1/C11H17N3O/c1-8-9(12)5-4-6-10(8)13-11(15)7-14(2)3/h4-6H,7,12H2,1-3H3,(H,13,15)
SMILES:Cc1c(cccc1N=C(CN(C)C)O)N
Synonyms:- Acetamide, N-(3-amino-2-methylphenyl)-2-(dimethylamino)-
- N1-(3-AMINO-2-METHYLPHENYL)-N2,N2-DIMETHYLGLYCINAMIDE
- UKRORGSYN-BB BBV-029038
- N~1~-(3-amino-2-methylphenyl)-N~2~,N~2~-dimethylglycinamide(SALTDATA: FREE)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.