
CAS 946784-20-9
:4-(2-Methoxy-4-methylphenoxy)-3-(trifluoromethyl)benzenamine
Description:
4-(2-Methoxy-4-methylphenoxy)-3-(trifluoromethyl)benzenamine, with the CAS number 946784-20-9, is an organic compound characterized by its complex structure, which includes a trifluoromethyl group and a methoxy-substituted aromatic ring. This compound features a phenoxy linkage, connecting a methoxy- and methyl-substituted phenyl group to a benzenamine moiety. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The methoxy group can participate in hydrogen bonding and may affect the compound's solubility and reactivity. Additionally, the overall structure suggests potential applications in pharmaceuticals, particularly in the development of compounds targeting specific biological pathways. The compound's stability, reactivity, and interactions with biological systems would depend on its electronic properties, steric hindrance, and the presence of functional groups. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C15H14F3NO2
InChI:InChI=1S/C15H14F3NO2/c1-9-3-5-13(14(7-9)20-2)21-12-6-4-10(19)8-11(12)15(16,17)18/h3-8H,19H2,1-2H3
InChI key:InChIKey=KOBGEUNDGSZYSJ-UHFFFAOYSA-N
SMILES:O(C1=C(C(F)(F)F)C=C(N)C=C1)C2=C(OC)C=C(C)C=C2
Synonyms:- 4-(2-Methoxy-4-methylphenoxy)-3-(trifluoromethyl)benzenamine
- Benzenamine, 4-(2-methoxy-4-methylphenoxy)-3-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.