
CAS 946784-36-7
:4-(2-Phenylethoxy)-2-(trifluoromethyl)benzenamine
Description:
4-(2-Phenylethoxy)-2-(trifluoromethyl)benzenamine, identified by its CAS number 946784-36-7, is an organic compound characterized by its complex structure that includes a trifluoromethyl group and an ether linkage. This compound features a phenylethoxy moiety, which contributes to its hydrophobic characteristics, and a trifluoromethyl group that enhances its electron-withdrawing properties, potentially influencing its reactivity and solubility. The presence of the amine functional group suggests that it may exhibit basic properties and can participate in hydrogen bonding, which could affect its interactions in various chemical environments. This compound may be of interest in pharmaceutical research or materials science due to its unique structural features, which could impart specific biological activities or physical properties. Additionally, the trifluoromethyl group is often associated with increased metabolic stability and lipophilicity, making such compounds valuable in drug design and development. Overall, the characteristics of this substance make it a candidate for further investigation in various chemical applications.
Formula:C15H14F3NO
InChI:InChI=1S/C15H14F3NO/c16-15(17,18)13-10-12(6-7-14(13)19)20-9-8-11-4-2-1-3-5-11/h1-7,10H,8-9,19H2
InChI key:InChIKey=QEPORWBBINATBX-UHFFFAOYSA-N
SMILES:O(CCC1=CC=CC=C1)C2=CC(C(F)(F)F)=C(N)C=C2
Synonyms:- 4-(2-Phenylethoxy)-2-(trifluoromethyl)benzenamine
- Benzenamine, 4-(2-phenylethoxy)-2-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.