
CAS 946784-51-6
:4-(2-Ethoxyphenoxy)-2-(trifluoromethyl)benzenamine
Description:
4-(2-Ethoxyphenoxy)-2-(trifluoromethyl)benzenamine, identified by its CAS number 946784-51-6, is an organic compound characterized by its complex structure that includes an amine functional group, a trifluoromethyl group, and an ethoxyphenoxy moiety. This compound typically exhibits properties associated with aromatic amines, such as moderate solubility in organic solvents and potential reactivity due to the presence of the amine group. The trifluoromethyl group contributes to its lipophilicity and can influence its electronic properties, making it potentially useful in various applications, including pharmaceuticals and agrochemicals. The ethoxy group enhances solubility and may affect the compound's biological activity. Additionally, the presence of multiple functional groups suggests that this compound could participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Overall, the unique combination of functional groups in 4-(2-Ethoxyphenoxy)-2-(trifluoromethyl)benzenamine may impart specific characteristics that are valuable in synthetic chemistry and material science.
Formula:C15H14F3NO2
InChI:InChI=1S/C15H14F3NO2/c1-2-20-13-5-3-4-6-14(13)21-10-7-8-12(19)11(9-10)15(16,17)18/h3-9H,2,19H2,1H3
InChI key:InChIKey=HTJZBOQSVMMURW-UHFFFAOYSA-N
SMILES:O(C1=C(OCC)C=CC=C1)C2=CC(C(F)(F)F)=C(N)C=C2
Synonyms:- 4-(2-Ethoxyphenoxy)-2-(trifluoromethyl)benzenamine
- Benzenamine, 4-(2-ethoxyphenoxy)-2-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.