CymitQuimica logo

CAS 946785-05-3

:

4-([1,1′-Biphenyl]-2-yloxy)-3-methylbenzenamine

Description:
4-([1,1′-Biphenyl]-2-yloxy)-3-methylbenzenamine, identified by its CAS number 946785-05-3, is an organic compound characterized by its complex structure, which includes a biphenyl moiety and an amine functional group. This compound features a methyl group and an ether linkage, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its hydrophobic biphenyl structure. The presence of the amine group suggests potential basicity and reactivity, particularly in nucleophilic substitution reactions. Additionally, the compound may display interesting electronic properties due to the conjugation between the biphenyl and aromatic amine systems, which can influence its behavior in various chemical environments. Its potential applications could span across fields such as materials science, pharmaceuticals, or organic synthesis, depending on its reactivity and stability under different conditions. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its toxicity and environmental impact.
Formula:C19H17NO
InChI:InChI=1S/C19H17NO/c1-14-13-16(20)11-12-18(14)21-19-10-6-5-9-17(19)15-7-3-2-4-8-15/h2-13H,20H2,1H3
InChI key:InChIKey=BMEWDYIQYPGKHP-UHFFFAOYSA-N
SMILES:O(C1=C(C=CC=C1)C2=CC=CC=C2)C3=C(C)C=C(N)C=C3
Synonyms:
  • 4-([1,1′-Biphenyl]-2-yloxy)-3-methylbenzenamine
  • Benzenamine, 4-([1,1′-biphenyl]-2-yloxy)-3-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.