CAS 946786-59-0
:5-Bromo-2-(3-methoxypropoxy)benzenamine
Description:
5-Bromo-2-(3-methoxypropoxy)benzenamine is an organic compound characterized by its aromatic structure, which includes a bromine substituent and an amine functional group. The presence of the bromine atom enhances its reactivity and can influence its physical properties, such as solubility and boiling point. The methoxypropoxy group contributes to the compound's hydrophobic characteristics, potentially affecting its interaction with biological systems and solvents. This compound may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its behavior in chemical reactions and biological applications. Additionally, the specific arrangement of substituents on the benzene ring can lead to unique electronic properties, making it of interest in medicinal chemistry and materials science. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity. Overall, 5-Bromo-2-(3-methoxypropoxy)benzenamine is a compound with diverse applications, particularly in research and development within the fields of pharmaceuticals and agrochemicals.
Formula:C10H14BrNO2
InChI:InChI=1S/C10H14BrNO2/c1-13-5-2-6-14-10-4-3-8(11)7-9(10)12/h3-4,7H,2,5-6,12H2,1H3
InChI key:InChIKey=VUXVTCCLTYVHAZ-UHFFFAOYSA-N
SMILES:O(CCCOC)C1=C(N)C=C(Br)C=C1
Synonyms:- Benzenamine, 5-bromo-2-(3-methoxypropoxy)-
- 5-Bromo-2-(3-methoxypropoxy)benzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.