
CAS 946786-74-9
:5-Bromo-2-(3-methoxyphenoxy)benzenamine
Description:
5-Bromo-2-(3-methoxyphenoxy)benzenamine is an organic compound characterized by its aromatic structure, which includes a bromine substituent and an amine functional group. The presence of the bromine atom enhances its reactivity and can influence its biological activity, making it a potential candidate for various applications in medicinal chemistry. The methoxyphenoxy group contributes to the compound's lipophilicity, which may affect its solubility and permeability in biological systems. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can be significant in its interactions with biological targets. Additionally, the presence of multiple aromatic rings suggests potential for π-π stacking interactions, which can be relevant in drug design and molecular recognition processes. Overall, 5-Bromo-2-(3-methoxyphenoxy)benzenamine's unique structural features may provide insights into its potential pharmacological properties and applications in research and development.
Formula:C13H12BrNO2
InChI:InChI=1S/C13H12BrNO2/c1-16-10-3-2-4-11(8-10)17-13-6-5-9(14)7-12(13)15/h2-8H,15H2,1H3
InChI key:InChIKey=FPXRWOYASKOHRI-UHFFFAOYSA-N
SMILES:O(C1=C(N)C=C(Br)C=C1)C2=CC(OC)=CC=C2
Synonyms:- 5-Bromo-2-(3-methoxyphenoxy)benzenamine
- Benzenamine, 5-bromo-2-(3-methoxyphenoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.