CAS 946786-95-4

5-Bromo-2-(2,4-difluorophenoxy)benzenamine

Description:

5-Bromo-2-(2,4-difluorophenoxy)benzenamine is an organic compound characterized by its complex structure, which includes a bromine atom and a difluorophenoxy group attached to a benzenamine core. This compound typically exhibits properties associated with aromatic amines, such as moderate solubility in organic solvents and potential reactivity due to the presence of the amine functional group. The bromine and fluorine substituents can influence its electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the presence of fluorine atoms often enhances lipophilicity and can affect the compound's biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in the development of agrochemicals or pharmaceuticals, particularly in the synthesis of more complex molecules. Safety and handling considerations should be taken into account due to the presence of halogens and the amine group, which may pose health risks if not managed properly.

Formula: C₁₂H₈BrF₂NO

InChI: InChI=1S/C12H8BrF2NO/c13-7-1-3-12(10(16)5-7)17-11-4-2-8(14)6-9(11)15/h1-6H,16H2

InChI key: InChIKey=PVVVFOBRPYJBNM-UHFFFAOYSA-N

SMILES: O(C1=C(F)C=C(F)C=C1)C2=C(N)C=C(Br)C=C2

Synonyms:

• Benzenamine, 5-bromo-2-(2,4-difluorophenoxy)-
• 5-Bromo-2-(2,4-difluorophenoxy)benzenamine