CymitQuimica logo

CAS 946787-03-7

:

3-[(3-Methylbutoxy)methyl]piperidine

Description:
3-[(3-Methylbutoxy)methyl]piperidine is an organic compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a 3-methylbutoxy group attached to the piperidine structure contributes to its unique properties, including potential hydrophobic characteristics due to the alkyl chain. This compound may exhibit moderate polarity, influenced by the piperidine nitrogen and the ether-like nature of the butoxy group. It is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as piperidine derivatives are often associated with various biological activities. Additionally, its solubility profile may allow for versatility in formulation within different solvents. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity. Overall, 3-[(3-Methylbutoxy)methyl]piperidine represents a compound of interest in both synthetic and applied chemistry contexts.
Formula:C11H23NO
InChI:InChI=1S/C11H23NO/c1-10(2)5-7-13-9-11-4-3-6-12-8-11/h10-12H,3-9H2,1-2H3
InChI key:InChIKey=QCXNMIQIRYFYMJ-UHFFFAOYSA-N
SMILES:C(OCCC(C)C)C1CCCNC1
Synonyms:
  • Piperidine, 3-[(3-methylbutoxy)methyl]-
  • 3-[(3-Methylbutoxy)methyl]piperidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.