CymitQuimica logo

CAS 946787-15-1

:

3-[(2-Bromophenoxy)methyl]piperidine

Description:
3-[(2-Bromophenoxy)methyl]piperidine is a chemical compound characterized by its piperidine ring, which is a six-membered nitrogen-containing heterocycle. The structure features a bromophenoxy group attached to the piperidine via a methylene bridge, indicating that it has both aromatic and aliphatic characteristics. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to the presence of the bromine atom and the ether linkage, which can influence its polarity. The bromine substituent can also impart unique reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the presence of the piperidine moiety suggests potential biological activity, as piperidine derivatives are often explored in medicinal chemistry for their pharmacological properties. Overall, 3-[(2-Bromophenoxy)methyl]piperidine is of interest in both synthetic organic chemistry and pharmaceutical research due to its structural features and potential applications.
Formula:C12H16BrNO
InChI:InChI=1S/C12H16BrNO/c13-11-5-1-2-6-12(11)15-9-10-4-3-7-14-8-10/h1-2,5-6,10,14H,3-4,7-9H2
InChI key:InChIKey=LWSGZNITGPTSRL-UHFFFAOYSA-N
SMILES:O(CC1CCCNC1)C2=C(Br)C=CC=C2
Synonyms:
  • 3-[(2-Bromophenoxy)methyl]piperidine
  • Piperidine, 3-[(2-bromophenoxy)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.