CAS 946843-80-7

copper(2+) 2,3-dihydroxybutanedioate hydrate

Description:

Copper(2+) 2,3-dihydroxybutanedioate hydrate, identified by the CAS number 946843-80-7, is a coordination compound featuring copper in its +2 oxidation state coordinated with the dihydroxybutanedioate ligand. This compound typically exhibits a blue-green color, characteristic of many copper(II) complexes. The presence of hydroxyl groups in the ligand contributes to its solubility in water and may influence its stability and reactivity. As a hydrate, it contains water molecules in its crystalline structure, which can affect its physical properties, such as melting point and solubility. The compound may exhibit various coordination geometries depending on the ligand's arrangement and the surrounding environment. In biological contexts, copper(II) complexes are often studied for their potential roles in enzymatic processes and as catalysts. Additionally, the compound's properties can be influenced by factors such as pH and temperature, making it of interest in both synthetic and applied chemistry fields.

Formula: C₄H₆CuO₇

InChI: InChI=1/C4H6O6.Cu.H2O/c5-1(3(7)8)2(6)4(9)10;;/h1-2,5-6H,(H,7,8)(H,9,10);;1H2/q;+2;/p-2

Copper(II) tartrate hydrate

CAS: 946843-80-7

Copper(II) tartrate hydrate

Formula: CuC₄H₄O₆·XH₂O

Color and Shape: green to blue xtl.

Molecular weight: 211.61

Ref: 08-93-2961

copper;2,3-dihydroxybutanedioate;hydrate

CAS: 946843-80-7

Formula: C₄H₆CuO₇

Purity: 98%

Color and Shape: Solid

Molecular weight: 229.6322

Ref: IN-DA00IIG8

Copper(II) L-tartrate xhydrate

CAS: 946843-80-7

Copper(II) L-tartrate xhydrate

Purity: 98%

Molecular weight: 229.63g/mol

Ref: 54-IN12853

Copper(II) tartrate hydrate

CAS: 946843-80-7

Formula: C₄H₄CuO₆·xH₂O

Purity: ≥ 98.0%

Color and Shape: Blue to green crystalline powder

Molecular weight: 211.62 (anhy.)

Ref: 7W-GW2432

Copper(II) tartrate hydrate

CAS: 946843-80-7

Copper(II) tartrate hydrate is an ionic compound that contains a covalent bond between copper and the carboxylate group of tartrate. This compound is a crystalline, structured solid with a unitary anion. It is soluble in water and has a blue-green color. Copper(II) tartrate hydrate is produced by heating potassium tartrates with copper ions in the gas phase. The resulting solution is then purified by crystallization to form the desired product.

Formula: C₄H₆O₆•Cu•(H₂O)x

Purity: Min. 95%

Color and Shape: Powder

Ref: 3D-WMB84380