CAS 946849-80-5

15-(9H-Fluoren-9-yl)-4,13-dioxo-14-oxa-8,9-dithia-5,12-diazapentadecanoic acid

Description:

15-(9H-Fluoren-9-yl)-4,13-dioxo-14-oxa-8,9-dithia-5,12-diazapentadecanoic acid, identified by its CAS number 946849-80-5, is a complex organic compound characterized by its unique structural features, including a fluorenyl group and multiple functional groups such as dioxo, oxa, and thia moieties. This compound is likely to exhibit significant solubility in organic solvents due to its hydrophobic fluorenyl component, while the presence of polar functional groups may impart some degree of hydrophilicity. Its structure suggests potential applications in medicinal chemistry, particularly in drug design, due to the presence of nitrogen and sulfur atoms, which can participate in various biological interactions. The compound may also exhibit interesting electronic properties owing to the conjugated system provided by the fluorenyl group. Additionally, its synthesis may involve multi-step organic reactions, highlighting its complexity and potential utility in advanced materials or pharmaceuticals. As with many such compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₂₃H₂₆N₂O₅S₂

InChI: InChI=1S/C23H26N2O5S2/c26-21(9-10-22(27)28)24-11-13-31-32-14-12-25-23(29)30-15-20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20/h1-8,20H,9-15H2,(H,24,26)(H,25,29)(H,27,28)

InChI key: InChIKey=ZZVHJSFCBULMRE-UHFFFAOYSA-N

SMILES: C(OC(NCCSSCCNC(CCC(O)=O)=O)=O)C1C=2C(C=3C1=CC=CC3)=CC=CC2

Synonyms:

• 14-Oxa-8,9-dithia-5,12-diazapentadecanoic acid, 15-(9H-fluoren-9-yl)-4,13-dioxo-
• 15-(9H-Fluoren-9-yl)-4,13-dioxo-14-oxa-8,9-dithia-5,12-diazapentadecanoic acid