CAS 94697-68-4
:5,6-O-isopropylidene-L-gulonic acid gamma-lactone
Description:
5,6-O-Isopropylidene-L-gulonic acid gamma-lactone, with the CAS number 94697-68-4, is a chemical compound that belongs to the class of lactones, specifically a cyclic ester derived from L-gulonic acid. This compound features a five-membered lactone ring, which is formed through the intramolecular reaction of the carboxylic acid and hydroxyl groups present in the molecule. The isopropylidene group provides steric hindrance, influencing the compound's reactivity and stability. Typically, this substance is characterized by its solubility in polar solvents, such as water and alcohols, due to the presence of hydroxyl groups. It may exhibit biological activity, potentially serving as an intermediate in the synthesis of other compounds or as a building block in organic synthesis. The compound's structure allows for various functional group transformations, making it a valuable target in synthetic organic chemistry. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in its handling and application.
Formula:C9H14O6
InChI:InChI=1/C9H14O6/c1-9(2)13-3-4(15-9)7-5(10)6(11)8(12)14-7/h4-7,10-11H,3H2,1-2H3/t4?,5-,6?,7+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5,6-O-Isopropylidene-L-gulono-1,4-lactone
CAS:<p>5,6-O-Isopropylidene-L-gulono-1,4-lactone is a glycerol derivative that has potent cytotoxic activity. It is able to inhibit the growth of cancer cells and induce apoptosis in human cell lines. 5,6-O-Isopropylidene-L-gulono-1,4-lactone can be used as an anti-cancer drug for the treatment of various types of cancers. The drug also has an ability to inhibit polyurethane synthesis and introduce new functional groups into polyurethanes. 5,6-O-Isopropylidene L gulono 1,4 lactone is not toxic to healthy cells because it does not bind to DNA or RNA; however it binds to polymers such as proteins and polyurethane chains. This compound has been shown to have a skeleton consisting of triterpenoid structures.</p>Formula:C9H14O6Molecular weight:218.20 g/mol5,6-O-Isopropylidene-L-gulonic acid-1,4-lactone
CAS:<p>5,6-O-Isopropylidene-L-gulonic acid-1,4-lactone is a synthetic monosaccharide with the molecular formula C8H14O5. It has a CAS number of 94697-68-4 and is available for custom synthesis. The chemical structure of 5,6-O-Isopropylidene-L-gulonic acid-1,4-lactone consists of a methyl group attached to the hydroxyl at position 1 and a fluoro group attached to the hydroxyl at position 4. 5,6--O--Isopropylidene--L--gulonic acid--1,4--lactone is not naturally occurring and is made by modification of glycosides. This compound can be used in click chemistry or complex carbohydrate reactions.</p>Formula:C9H14O6Purity:Min. 99 Area-%Color and Shape:White PowderMolecular weight:218.2 g/mol5,6-O-Isopropylidene-L-gulono-1,4-lactone
CAS:Controlled Product<p>Applications A useful starting material for the synthesis of an array of compounds modified in the 2 and 3 positions.<br>References Vekemans, J.A.J., et al.: Recl. Trav. Chim. Pays-Bas, 104, 266 (1985), Hubschwerlen, Synthesis, 962 (1986)<br></p>Formula:C9H14O6Color and Shape:NeatMolecular weight:218.20


