CAS 947-82-0

4,4,5-trimethyl-2-phenyl-2,4-dihydro-3H-pyrazol-3-one

Description:

4,4,5-Trimethyl-2-phenyl-2,4-dihydro-3H-pyrazol-3-one, with the CAS number 947-82-0, is an organic compound characterized by its pyrazolone structure, which features a five-membered ring containing two nitrogen atoms. This compound typically exhibits a white to off-white crystalline appearance and is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. It possesses a range of functional groups, including methyl and phenyl substituents, which contribute to its chemical reactivity and solubility properties. The presence of the pyrazolone moiety often imparts biological activity, making it a subject of interest in medicinal chemistry. Additionally, this compound may exhibit properties such as antioxidant activity, which can be beneficial in various formulations. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, making it important to consider these conditions in practical applications. Overall, 4,4,5-trimethyl-2-phenyl-2,4-dihydro-3H-pyrazol-3-one is a versatile compound with significant potential in chemical research and development.

Formula: C₁₂H₁₄N₂O

InChI: InChI=1/C12H14N2O/c1-9-12(2,3)11(15)14(13-9)10-7-5-4-6-8-10/h4-8H,1-3H3

SMILES: CC1=NN(c2ccccc2)C(=O)C1(C)C

Synonyms:

• 2-Pyrazolin-5-one, 3,4,4-trimethyl-1-phenyl-
• 3H-pyrazol-3-one, 2,4-dihydro-4,4,5-trimethyl-2-phenyl-