CAS 947012-62-6
:3-(1H-Imidazol-1-ylmethyl)-4-(1-methylethoxy)benzaldehyde
Description:
3-(1H-Imidazol-1-ylmethyl)-4-(1-methylethoxy)benzaldehyde, with the CAS number 947012-62-6, is an organic compound characterized by its complex structure, which includes an imidazole ring and a benzaldehyde functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the aldehyde group. The imidazole moiety can participate in various chemical reactions, including coordination with metal ions and formation of hydrogen bonds, which may enhance its biological activity. The presence of the methoxy group contributes to its lipophilicity, potentially influencing its solubility in organic solvents. This compound may be of interest in medicinal chemistry and material science due to its unique structural features, which could lead to applications in drug development or as a building block in organic synthesis. Its specific reactivity and interactions would depend on the surrounding chemical environment and conditions.
Formula:C14H16N2O2
InChI:InChI=1S/C14H16N2O2/c1-11(2)18-14-4-3-12(9-17)7-13(14)8-16-6-5-15-10-16/h3-7,9-11H,8H2,1-2H3
InChI key:InChIKey=UWMWGLGHZZJUJW-UHFFFAOYSA-N
SMILES:C(C1=C(OC(C)C)C=CC(C=O)=C1)N2C=CN=C2
Synonyms:- 3-(1H-Imidazol-1-ylmethyl)-4-(1-methylethoxy)benzaldehyde
- Benzaldehyde, 3-(1H-imidazol-1-ylmethyl)-4-(1-methylethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.