CymitQuimica logo

CAS 947012-65-9

:

4-(1-Methylethoxy)-3-(1-pyrrolidinylmethyl)benzaldehyde

Description:
4-(1-Methylethoxy)-3-(1-pyrrolidinylmethyl)benzaldehyde, with the CAS number 947012-65-9, is an organic compound characterized by its complex structure, which includes a benzaldehyde moiety substituted with both a methylethoxy group and a pyrrolidinylmethyl group. This compound typically exhibits properties associated with aromatic aldehydes, such as a distinct aromatic odor and potential reactivity in electrophilic aromatic substitution reactions. The presence of the pyrrolidine ring suggests that it may also exhibit basic properties due to the nitrogen atom, which can participate in hydrogen bonding and influence solubility in various solvents. Additionally, the methylethoxy group can enhance lipophilicity, potentially affecting the compound's biological activity and interaction with cellular membranes. Overall, this compound may be of interest in medicinal chemistry and material science due to its unique structural features and potential applications in drug development or as a synthetic intermediate.
Formula:C15H21NO2
InChI:InChI=1S/C15H21NO2/c1-12(2)18-15-6-5-13(11-17)9-14(15)10-16-7-3-4-8-16/h5-6,9,11-12H,3-4,7-8,10H2,1-2H3
InChI key:InChIKey=KWOPYDHXAZUUOS-UHFFFAOYSA-N
SMILES:C(C1=C(OC(C)C)C=CC(C=O)=C1)N2CCCC2
Synonyms:
  • Benzaldehyde, 4-(1-methylethoxy)-3-(1-pyrrolidinylmethyl)-
  • 4-(1-Methylethoxy)-3-(1-pyrrolidinylmethyl)benzaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.