CymitQuimica logo

CAS 947013-68-5

:

5-Chloro-1-methyl-1H-benzimidazole-2-carboxylic acid

Description:
5-Chloro-1-methyl-1H-benzimidazole-2-carboxylic acid is a chemical compound characterized by its benzimidazole core, which features a chlorine substituent at the 5-position and a carboxylic acid group at the 2-position. This compound typically exhibits properties associated with heterocyclic aromatic compounds, including potential solubility in polar solvents due to the presence of the carboxylic acid group. The chlorine atom introduces electronegativity, which can influence the compound's reactivity and interaction with biological systems. The methyl group at the 1-position contributes to the overall hydrophobic character of the molecule. This compound may be of interest in pharmaceutical research and development, particularly for its potential biological activities, including antimicrobial or anticancer properties. Its structural features suggest that it could participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it a versatile building block in organic synthesis. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C9H7ClN2O2
InChI:InChI=1S/C9H7ClN2O2/c1-12-7-3-2-5(10)4-6(7)11-8(12)9(13)14/h2-4H,1H3,(H,13,14)
InChI key:InChIKey=GVLUKGCSZAAZJI-UHFFFAOYSA-N
SMILES:CN1C=2C(N=C1C(O)=O)=CC(Cl)=CC2
Synonyms:
  • 5-Chloro-1-methyl-1H-benzimidazole-2-carboxylic acid
  • 1H-Benzimidazole-2-carboxylic acid, 5-chloro-1-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.