CAS 947013-71-0

5-Chloro-1-methyl-1H-benzimidazole-2-butanoic acid

Description:

5-Chloro-1-methyl-1H-benzimidazole-2-butanoic acid is a chemical compound characterized by its unique structure, which includes a benzimidazole ring substituted with a chlorine atom and a butanoic acid moiety. This compound typically exhibits properties associated with both aromatic and aliphatic functionalities, contributing to its potential biological activity. The presence of the chlorine atom may influence its reactivity and solubility, while the butanoic acid group can impart acidic characteristics. As a benzimidazole derivative, it may exhibit pharmacological properties, making it of interest in medicinal chemistry. The compound's molecular structure suggests it could participate in hydrogen bonding and other intermolecular interactions, which are crucial for its behavior in biological systems. Additionally, its synthesis and stability under various conditions are important for its application in research and potential therapeutic uses. Overall, 5-Chloro-1-methyl-1H-benzimidazole-2-butanoic acid represents a compound with significant chemical diversity and potential utility in various fields, including pharmaceuticals and agrochemicals.

Formula: C₁₂H₁₃ClN₂O₂

InChI: InChI=1S/C12H13ClN2O2/c1-15-10-6-5-8(13)7-9(10)14-11(15)3-2-4-12(16)17/h5-7H,2-4H2,1H3,(H,16,17)

InChI key: InChIKey=LKRNBBIFVGBJNQ-UHFFFAOYSA-N

SMILES: CN1C=2C(N=C1CCCC(O)=O)=CC(Cl)=CC2

Synonyms:

• 1H-Benzimidazole-2-butanoic acid, 5-chloro-1-methyl-
• 5-Chloro-1-methyl-1H-benzimidazole-2-butanoic acid

4-(5-Chloro-1-methyl-1H-benzoimidazol-2-yl)-butyric acid

Controlled Product

CAS: 947013-71-0

Please enquire for more information about 4-(5-Chloro-1-methyl-1H-benzoimidazol-2-yl)-butyric acid including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₂H₁₃ClN₂O₂

Purity: Min. 95%

Molecular weight: 252.69 g/mol

Ref: 3D-XMB01371