CAS 94708-08-4

4-[(5E)-5-(phenylmethylidene)cyclopent-1-en-1-yl]morpholine

Description:

4-[(5E)-5-(phenylmethylidene)cyclopent-1-en-1-yl]morpholine, with the CAS number 94708-08-4, is an organic compound characterized by its unique structural features. It contains a morpholine ring, which is a six-membered heterocyclic compound featuring one nitrogen atom and five carbon atoms. The compound also includes a cyclopentene moiety with a phenylmethylidene substituent, contributing to its potential reactivity and stability. The presence of the double bond in the cyclopentene structure suggests that it may participate in various chemical reactions, such as electrophilic additions or polymerizations. Additionally, the phenyl group can enhance the compound's lipophilicity, potentially affecting its solubility and interaction with biological systems. The compound's specific stereochemistry, indicated by the (5E) configuration, may influence its biological activity and interactions. Overall, this compound's unique combination of functional groups and structural features makes it of interest in fields such as medicinal chemistry and materials science.

Formula: C₁₆H₁₉NO

InChI: InChI=1/C16H19NO/c1-2-5-14(6-3-1)13-15-7-4-8-16(15)17-9-11-18-12-10-17/h1-3,5-6,8,13H,4,7,9-12H2/b15-13+

Synonyms:

• 4-(5-Benzylidene-cyclopent-1-enyl)-morpholine

4-[5-(Phenylmethylidene)cyclopent-1-en-1-yl]morpholine

CAS: 94708-08-4

Versatile small molecule scaffold

Formula: C₁₆H₁₉NO

Purity: Min. 95%

Molecular weight: 241.33 g/mol

Ref: 3D-UDA70808