CAS 947144-38-9

3-Nitro-4-[(phenylmethyl)amino]-6-(trifluoromethyl)-2(1H)-pyridinone

Description:

3-Nitro-4-[(phenylmethyl)amino]-6-(trifluoromethyl)-2(1H)-pyridinone is a chemical compound characterized by its complex structure, which includes a pyridinone core substituted with a nitro group, a phenylmethylamino group, and a trifluoromethyl group. The presence of the nitro group typically indicates potential reactivity and may influence the compound's electronic properties, making it a candidate for various chemical reactions. The trifluoromethyl group is known for imparting lipophilicity and can enhance the compound's biological activity. The phenylmethylamino moiety suggests potential interactions with biological targets, making this compound of interest in medicinal chemistry. Its molecular structure may contribute to its solubility and stability in various solvents, which is crucial for applications in pharmaceuticals or agrochemicals. Additionally, the compound's unique combination of functional groups may lead to specific pharmacological effects, warranting further investigation into its potential uses in drug development or as a research tool in biochemical studies.

Formula: C₁₃H₁₀F₃N₃O₃

InChI: InChI=1S/C13H10F3N3O3/c14-13(15,16)10-6-9(11(19(21)22)12(20)18-10)17-7-8-4-2-1-3-5-8/h1-6H,7H2,(H2,17,18,20)

InChI key: InChIKey=NTFWVXUVSRJIIW-UHFFFAOYSA-N

SMILES: N(CC1=CC=CC=C1)C2=C(N(=O)=O)C(=O)NC(C(F)(F)F)=C2

Synonyms:

• 2(1H)-Pyridinone, 3-nitro-4-[(phenylmethyl)amino]-6-(trifluoromethyl)-
• 4-(Benzylamino)-3-nitro-6-(trifluoromethyl)pyridin-2-ol
• 3-Nitro-4-[(phenylmethyl)amino]-6-(trifluoromethyl)-2(1H)-pyridinone