
CAS 947149-88-4
:N,N,3-Trimethyl-3-pyrrolidinamine
Description:
N,N,3-Trimethyl-3-pyrrolidinamine is an organic compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. This compound features three methyl groups attached to the nitrogen atom of the pyrrolidine ring, contributing to its unique properties. It is a colorless to pale yellow liquid at room temperature and is soluble in polar organic solvents. The presence of the amine functional group makes it a basic compound, capable of forming salts with acids. Its molecular structure allows for potential applications in various fields, including pharmaceuticals and agrochemicals, due to its ability to interact with biological systems. Additionally, the trimethyl substitution can influence its reactivity and steric properties, making it an interesting subject for further chemical research. Safety data should be consulted for handling, as amines can be irritants and may pose health risks. Overall, N,N,3-Trimethyl-3-pyrrolidinamine is a versatile compound with significant implications in synthetic chemistry and material science.
Formula:C7H16N2
InChI:InChI=1S/C7H16N2/c1-7(9(2)3)4-5-8-6-7/h8H,4-6H2,1-3H3
InChI key:InChIKey=BHGAPHJDUGWGCK-UHFFFAOYSA-N
SMILES:N(C)(C)C1(C)CCNC1
Synonyms:- N,N,3-Trimethyl-3-pyrrolidinamine
- 3-Pyrrolidinamine, N,N,3-trimethyl-
- Dimethyl(3-methylpyrrolidin-3-yl)amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.