
CAS 947162-61-0
:1,3-Dihydro-1-hydroxy-2,1-benzoxaborole-7-carbonitrile
Description:
1,3-Dihydro-1-hydroxy-2,1-benzoxaborole-7-carbonitrile is a chemical compound characterized by its unique structural features, which include a benzoxaborole core and a cyano group. This compound typically exhibits a boron atom integrated into a cyclic structure, contributing to its reactivity and potential applications in medicinal chemistry. The presence of the hydroxyl group enhances its solubility and may influence its interaction with biological targets. The cyano group introduces additional polarity and can participate in various chemical reactions, making it a versatile building block in organic synthesis. This compound is of interest in the development of pharmaceuticals, particularly due to its potential antibacterial properties. Its molecular structure allows for specific interactions with biological macromolecules, which can be leveraged in drug design. As with many boron-containing compounds, it may also exhibit unique properties such as Lewis acidity, which can be exploited in catalysis or material science. Overall, 1,3-Dihydro-1-hydroxy-2,1-benzoxaborole-7-carbonitrile represents a significant compound in the field of chemistry with promising applications.
Formula:C8H6BNO2
InChI:InChI=1S/C8H6BNO2/c10-4-6-2-1-3-7-5-12-9(11)8(6)7/h1-3,11H,5H2
InChI key:InChIKey=LDDSWFYJGUDUEC-UHFFFAOYSA-N
SMILES:C(#N)C1=C2C(COB2O)=CC=C1
Synonyms:- 1,3-Dihydro-1-hydroxy-2,1-benzoxaborole-7-carbonitrile
- 2,1-Benzoxaborole-7-carbonitrile, 1,3-dihydro-1-hydroxy-
- 1-Hydroxy-1,3-dihydro-2,1-benzoxaborole-7-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.