CymitQuimica logo

CAS 947165-27-7

:

1,3-Dihydro-1-hydroxy-2,1-benzoxaborol-7-amine

Description:
1,3-Dihydro-1-hydroxy-2,1-benzoxaborol-7-amine, with the CAS number 947165-27-7, is a chemical compound that belongs to the class of boron-containing heterocycles. This substance features a benzoxaborole structure, which is characterized by the presence of a boron atom integrated into a cyclic system that includes both oxygen and nitrogen functionalities. The compound exhibits a range of interesting properties, including potential applications in medicinal chemistry, particularly as an antimicrobial agent or in the treatment of various diseases due to its ability to interact with biological targets. Its unique structure allows for the formation of hydrogen bonds, which can enhance its solubility and reactivity. Additionally, the presence of the amine group contributes to its basicity and potential for further chemical modifications. Overall, 1,3-Dihydro-1-hydroxy-2,1-benzoxaborol-7-amine is a versatile compound with significant implications in pharmaceutical research and development.
Formula:C7H8BNO2
InChI:InChI=1S/C7H8BNO2/c9-6-3-1-2-5-4-11-8(10)7(5)6/h1-3,10H,4,9H2
InChI key:InChIKey=CKCYPHOOQTYHRK-UHFFFAOYSA-N
SMILES:NC1=C2C(=CC=C1)COB2O
Synonyms:
  • 2,1-Benzoxaborol-7-amine, 1,3-dihydro-1-hydroxy-
  • 1,3-Dihydro-1-hydroxy-2,1-benzoxaborol-7-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.