
CAS 947179-29-5
:6-Methyl-N-(2-methyl-4-thiazolyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinecarboxamide
Description:
6-Methyl-N-(2-methyl-4-thiazolyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinecarboxamide is a chemical compound characterized by its complex structure, which includes a pyridine ring, a thiazole moiety, and a boron-containing dioxaborolane group. This compound is likely to exhibit properties typical of amides, such as moderate solubility in polar solvents and potential for hydrogen bonding due to the presence of the amide functional group. The presence of the thiazole and pyridine rings suggests potential biological activity, possibly as a pharmaceutical agent, given their prevalence in medicinal chemistry. The boron-containing dioxaborolane group may impart unique reactivity, particularly in organoboron chemistry, making it useful in various synthetic applications. Additionally, the methyl groups contribute to steric hindrance, which can influence the compound's reactivity and interaction with biological targets. Overall, this compound's unique structural features may lead to interesting chemical behavior and potential applications in drug development or materials science.
Formula:C17H22BN3O3S
InChI:InChI=1S/C17H22BN3O3S/c1-10-7-12(18-23-16(3,4)17(5,6)24-18)8-13(19-10)15(22)21-14-9-25-11(2)20-14/h7-9H,1-6H3,(H,21,22)
InChI key:InChIKey=NJHXDYAKOFCPQD-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=C(C(NC=3N=C(C)SC3)=O)N=C(C)C2
Synonyms:- 6-Methyl-N-(2-methyl-4-thiazolyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinecarboxamide
- 2-Pyridinecarboxamide, 6-methyl-N-(2-methyl-4-thiazolyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Pyridinecarboxamide, 6-methyl-n-(2-methyl-4-thiazolyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
CAS:Formula:C17H22BN3O3SMolecular weight:359.2509
