CymitQuimica logo

CAS 947179-30-8

:

6-Methyl-N-(2-methyl-4-pyridinyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinecarboxamide

Description:
6-Methyl-N-(2-methyl-4-pyridinyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinecarboxamide, with CAS number 947179-30-8, is a synthetic organic compound characterized by its complex molecular structure, which includes multiple functional groups such as amides and boron-containing moieties. This compound features a pyridine ring, which contributes to its aromatic properties and potential biological activity. The presence of the dioxaborolane group suggests that it may have applications in medicinal chemistry, particularly in drug design or as a building block for further chemical synthesis. The methyl and pyridinyl substituents can influence its solubility, reactivity, and interaction with biological targets. Additionally, the compound's structural features may impart specific pharmacological properties, making it of interest in the development of therapeutic agents. Overall, its unique combination of elements and functional groups positions it as a potentially valuable compound in various chemical and pharmaceutical applications.
Formula:C19H24BN3O3
InChI:InChI=1S/C19H24BN3O3/c1-12-10-15(7-8-21-12)23-17(24)16-11-14(9-13(2)22-16)20-25-18(3,4)19(5,6)26-20/h7-11H,1-6H3,(H,21,23,24)
InChI key:InChIKey=PNIMSWKAXUKHIA-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=C(C(NC=3C=C(C)N=CC3)=O)N=C(C)C2
Synonyms:
  • 2-Pyridinecarboxamide, 6-methyl-N-(2-methyl-4-pyridinyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
  • 6-Methyl-N-(2-methyl-4-pyridinyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinecarboxamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.