CymitQuimica logo

CAS 947179-32-0

:

6-Methyl-N-(1-methyl-1H-pyrazol-3-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinecarboxamide

Description:
6-Methyl-N-(1-methyl-1H-pyrazol-3-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinecarboxamide is a complex organic compound characterized by its unique structural features, including a pyridine ring, a pyrazole moiety, and a boron-containing dioxaborolane group. This compound is likely to exhibit properties typical of amides, such as moderate solubility in polar solvents and potential for hydrogen bonding due to the presence of the amide functional group. The presence of the boron moiety may impart specific reactivity, particularly in coordination chemistry or as a potential ligand in catalysis. Additionally, the methyl groups contribute to steric hindrance, which can influence the compound's reactivity and interaction with biological targets. Given its structural complexity, this compound may have applications in medicinal chemistry or materials science, although specific biological activity or reactivity would require empirical investigation. Overall, its unique combination of functional groups suggests potential utility in various chemical contexts.
Formula:C17H23BN4O3
InChI:InChI=1S/C17H23BN4O3/c1-11-9-12(18-24-16(2,3)17(4,5)25-18)10-13(19-11)15(23)20-14-7-8-22(6)21-14/h7-10H,1-6H3,(H,20,21,23)
InChI key:InChIKey=PYLYNLBYXADNMZ-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=C(C(NC3=NN(C)C=C3)=O)N=C(C)C2
Synonyms:
  • 6-Methyl-N-(1-methyl-1H-pyrazol-3-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinecarboxamide
  • 2-Pyridinecarboxamide, 6-methyl-N-(1-methyl-1H-pyrazol-3-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.