CAS 94720-19-1
:2,3,4,5,6-pentafluoro-N-(2-oxo-2,3-dihydropyrimidin-4-yl)benzamide
Description:
2,3,4,5,6-Pentafluoro-N-(2-oxo-2,3-dihydropyrimidin-4-yl)benzamide is a fluorinated organic compound characterized by the presence of five fluorine atoms attached to a benzamide structure. This compound features a dihydropyrimidine moiety, which contributes to its potential biological activity. The presence of multiple fluorine atoms typically enhances the lipophilicity and metabolic stability of the compound, making it of interest in pharmaceutical applications. The carbonyl group in the dihydropyrimidine ring suggests potential reactivity, while the benzamide portion may influence its interaction with biological targets. The compound's unique structure may impart specific properties such as increased potency or selectivity in biological assays. Additionally, the fluorinated nature of the compound can affect its solubility and overall chemical behavior, making it a subject of interest in medicinal chemistry and materials science. Overall, this compound exemplifies the intersection of organic synthesis and biological activity, highlighting the importance of structural modifications in drug design.
Formula:C11H4F5N3O2
InChI:InChI=1/C11H4F5N3O2/c12-5-4(6(13)8(15)9(16)7(5)14)10(20)18-3-1-2-17-11(21)19-3/h1-2H,(H2,17,18,19,20,21)
SMILES:c1cnc([nH]c1=NC(=O)c1c(c(c(c(c1F)F)F)F)F)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.