CAS 947238-42-8

3-Bromo-4-chloro-1H-pyrrolo[3,2-c]pyridine

Description:

3-Bromo-4-chloro-1H-pyrrolo[3,2-c]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of bromine and chlorine substituents enhances its reactivity and potential for further chemical modifications. This compound typically exhibits a solid state at room temperature and is soluble in organic solvents, making it suitable for various synthetic applications. Its structure allows for potential interactions with biological targets, which may be of interest in pharmaceutical research. The compound's molecular framework can facilitate participation in electrophilic and nucleophilic reactions, making it a valuable intermediate in organic synthesis. Additionally, its specific arrangement of halogen atoms can influence its electronic properties, potentially affecting its behavior in chemical reactions and interactions with other molecules. Overall, 3-Bromo-4-chloro-1H-pyrrolo[3,2-c]pyridine is a versatile compound with applications in medicinal chemistry and materials science.

Formula: C₇H₄BrClN₂

InChI: InChI=1/C7H4BrClN2/c8-4-3-11-5-1-2-10-7(9)6(4)5/h1-3,11H

SMILES: c1cnc(c2c(c[nH]c12)Br)Cl

Synonyms:

• 1H-pyrrolo[3,2-c]pyridine, 3-bromo-4-chloro-

3-Bromo-4-chloro-1H-pyrrolo[3,2-c]pyridine

CAS: 947238-42-8

Formula: C₇H₄BrClN₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 231.4771

Ref: IN-DA003J1D

3-Bromo-4-chloro-1H-pyrrolo[3,2-c]pyridine

CAS: 947238-42-8

3-Bromo-4-chloro-1H-pyrrolo[3,2-c]pyridine

Formula: C₇H₄BrClN₂

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 231.48g/mol

Ref: 54-OR300374

3-Bromo-4-chloro-1H-pyrrolo[3,2-c]pyridine

CAS: 947238-42-8

Formula: C₇H₄BrClN₂

Purity: 95%

Molecular weight: 231.48

Ref: 10-F321168