CymitQuimica logo

CAS 947248-69-3

:

N-(6-Bromo-5-methylimidazo[1,2-a]pyridin-2-yl)-2,2,2-trifluoroacetamide

Description:
N-(6-Bromo-5-methylimidazo[1,2-a]pyridin-2-yl)-2,2,2-trifluoroacetamide is a synthetic organic compound characterized by its complex structure, which includes an imidazo[1,2-a]pyridine moiety and a trifluoroacetamide functional group. The presence of the bromine atom and the trifluoroacetamide group contributes to its unique chemical properties, such as increased lipophilicity and potential biological activity. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its molecular structure suggests potential interactions with biological targets, which could be explored in various therapeutic contexts. Additionally, the trifluoroacetamide group may enhance the compound's stability and solubility in organic solvents. As with many halogenated compounds, it is essential to consider the environmental and health implications associated with its use and disposal. Overall, this compound represents a valuable entity for research in both chemical synthesis and biological applications.
Formula:C10H7BrF3N3O
InChI:InChI=1S/C10H7BrF3N3O/c1-5-6(11)2-3-8-15-7(4-17(5)8)16-9(18)10(12,13)14/h2-4H,1H3,(H,16,18)
InChI key:InChIKey=CEWMQZKTQYSJIX-UHFFFAOYSA-N
SMILES:CC=1N2C(=NC(NC(C(F)(F)F)=O)=C2)C=CC1Br
Synonyms:
  • 2,2,2-Trifluoro-N-(6-Bromo-5-methylimidazo[1,2-a]pyridin-2-yl)acetamide
  • Acetamide, N-(6-bromo-5-methylimidazo[1,2-a]pyridin-2-yl)-2,2,2-trifluoro-
  • N-(6-Bromo-5-methylimidazo[1,2-a]pyridin-2-yl)-2,2,2-trifluoroacetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.