CymitQuimica logo

CAS 947249-01-6

:

2-Amino-3-(trifluoromethyl) pyridine-5-boronic acid pinacol ester

Description:
2-Amino-3-(trifluoromethyl)pyridine-5-boronic acid pinacol ester is a chemical compound characterized by its boronic acid functionality, which is significant in various organic synthesis applications, particularly in Suzuki coupling reactions. The presence of the trifluoromethyl group enhances its electronic properties, making it a valuable intermediate in the development of pharmaceuticals and agrochemicals. The pinacol ester moiety contributes to its stability and solubility, facilitating its use in various chemical reactions. This compound typically exhibits moderate to high polarity due to the amino and boronic acid groups, which can engage in hydrogen bonding. Its structure includes a pyridine ring, which imparts aromatic characteristics and influences its reactivity. Additionally, the trifluoromethyl group can affect the compound's lipophilicity and overall biological activity. As with many boronic acids, it is important to handle this compound with care, as it may exhibit sensitivity to moisture and air, which can lead to hydrolysis and loss of reactivity.
Formula:C12H16BF3N2O2
InChI:InChI=1S/C12H16BF3N2O2/c1-10(2)11(3,4)20-13(19-10)7-5-8(12(14,15)16)9(17)18-6-7/h5-6H,1-4H3,(H2,17,18)
InChI key:OQZKROYNCVLJKM-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(N=C2)N)C(F)(F)F
Found 5 products.