CAS 947329-82-0
:1-[4-[3-[diethoxy(methoxymethyl)silyl]propyl]-3-methoxy-phenyl]-7-[3-methoxy-4-(3-triethoxysilylpropyl)phenyl]heptane-3,5-dione
Description:
The chemical substance known as "1-[4-[3-[diethoxy(methoxymethyl)silyl]propyl]-3-methoxy-phenyl]-7-[3-methoxy-4-(3-triethoxysilylpropyl)phenyl]heptane-3,5-dione," with the CAS number 947329-82-0, is a complex organic compound characterized by its multi-functional silane structure. It features multiple alkoxy groups, specifically diethoxy and triethoxy moieties, which enhance its reactivity and potential for forming siloxane bonds. The presence of methoxy groups contributes to its solubility in organic solvents and may influence its electronic properties. The heptane backbone, along with the dione functional groups, suggests potential applications in materials science, particularly in the development of hybrid organic-inorganic materials. This compound may exhibit interesting properties such as adhesion, hydrophobicity, and thermal stability, making it suitable for use in coatings, sealants, or as a coupling agent in composite materials. Its intricate structure indicates a potential for diverse applications in fields such as nanotechnology, surface modification, and organic synthesis. However, specific physical and chemical properties would require empirical measurement or detailed computational analysis for precise characterization.
Formula:C39H64O10Si2
InChI:InChI=1/C39H64O10Si2/c1-9-45-50(31-42-6,46-10-2)26-14-16-34-22-18-32(28-38(34)43-7)20-24-36(40)30-37(41)25-21-33-19-23-35(39(29-33)44-8)17-15-27-51(47-11-3,48-12-4)49-13-5/h18-19,22-23,28-29H,9-17,20-21,24-27,30-31H2,1-8H3
SMILES:CCO[Si](CCCc1ccc(CCC(=O)CC(=O)CCc2ccc(CCC[Si](OCC)(OCC)OCC)c(c2)OC)cc1OC)(COC)OCC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.