CymitQuimica logo

CAS 947330-58-7

:

3-Nitro-2-(phenylethynyl)pyridine

Description:
3-Nitro-2-(phenylethynyl)pyridine is an organic compound characterized by its pyridine ring, which is substituted at the 2-position with a phenylethynyl group and at the 3-position with a nitro group. This compound typically exhibits a yellow to orange crystalline appearance. The presence of the nitro group introduces significant polarity and can influence the compound's reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The phenylethynyl moiety contributes to its aromatic character and can enhance its electronic properties, potentially making it useful in organic synthesis and materials science. Additionally, the compound may exhibit interesting biological activities, which could be explored in medicinal chemistry. Its solubility and stability in various solvents can vary, depending on the specific conditions and the presence of functional groups. Overall, 3-Nitro-2-(phenylethynyl)pyridine is a versatile compound with potential applications in research and industry.
Formula:C13H8N2O2
InChI:InChI=1/C13H8N2O2/c16-15(17)13-7-4-10-14-12(13)9-8-11-5-2-1-3-6-11/h1-7,10H
Synonyms:
  • pyridine, 3-nitro-2-(2-phenylethynyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.