CAS 947331-10-4

2-butyl-5-chloro-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylic acid

Description:

2-butyl-5-chloro-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylic acid is a complex organic compound characterized by its imidazole core, which is a five-membered heterocyclic structure containing nitrogen atoms. This compound features a butyl group, a chlorine substituent, and a carboxylic acid functional group, contributing to its potential solubility and reactivity. The presence of a trityltetrazole moiety indicates that it may exhibit unique electronic properties and biological activity, possibly making it relevant in pharmaceutical applications. The compound's structure suggests it could participate in hydrogen bonding due to the carboxylic acid group, influencing its interactions in biological systems. Additionally, the presence of multiple aromatic rings may enhance its stability and lipophilicity. Overall, this compound's intricate structure and functional groups suggest potential utility in medicinal chemistry, particularly in the development of targeted therapies or as a biochemical probe.

Formula: C₄₁H₃₅ClN₆O₂

InChI: InChI=1/C41H35ClN6O2/c1-2-3-23-36-43-38(42)37(40(49)50)47(36)28-29-24-26-30(27-25-29)34-21-13-14-22-35(34)39-44-45-46-48(39)41(31-15-7-4-8-16-31,32-17-9-5-10-18-32)33-19-11-6-12-20-33/h4-22,24-27H,2-3,23,28H2,1H3,(H,49,50)

SMILES: CCCCc1nc(c(C(=O)O)n1Cc1ccc(cc1)c1ccccc1c1nnnn1C(c1ccccc1)(c1ccccc1)c1ccccc1)Cl