CAS 947339-99-3
:4-chloro-6,7,8-trifluoro-quinoline-3-carbonitrile
Description:
4-Chloro-6,7,8-trifluoro-quinoline-3-carbonitrile is a synthetic organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom in the heterocyclic ring. This compound features multiple halogen substituents, specifically three fluorine atoms and one chlorine atom, which significantly influence its chemical reactivity and physical properties. The presence of the cyano group (-C≡N) at the 3-position enhances its potential as a versatile building block in organic synthesis and medicinal chemistry. The trifluoromethyl groups contribute to the compound's lipophilicity and may enhance biological activity, making it of interest in pharmaceutical research. Additionally, the compound's unique combination of functional groups may impart specific electronic properties, affecting its interaction with biological targets. Overall, 4-chloro-6,7,8-trifluoro-quinoline-3-carbonitrile is notable for its potential applications in drug development and as a reagent in various chemical reactions.
Formula:C10H2ClF3N2
InChI:InChI=1/C10H2ClF3N2/c11-7-4(2-15)3-16-10-5(7)1-6(12)8(13)9(10)14/h1,3H
SMILES:c1c2c(c(C#N)cnc2c(c(c1F)F)F)Cl
Synonyms:- 4-Chlor-6,7,8-trifluorchinolin-3-carbonitril
- 4-Chloro-6,7,8-Trifluoroquinoline-3-Carbonitrile
- 3-Quinolinecarbonitrile, 4-chloro-6,7,8-trifluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
