CAS 94738-31-5
:(2,4-dioxoimidazolidin-1-yl)acetic acid
Description:
(2,4-Dioxoimidazolidin-1-yl)acetic acid, with the CAS number 94738-31-5, is a chemical compound characterized by its imidazolidine ring structure, which features two carbonyl (keto) groups at the 2 and 4 positions. This compound is an amino acid derivative, incorporating a carboxylic acid functional group, which contributes to its acidic properties. The presence of the imidazolidine ring suggests potential biological activity, as many compounds with similar structures are known to exhibit pharmacological effects. The compound is likely to be soluble in polar solvents due to the presence of the carboxylic acid group, and its stability may be influenced by the tautomeric forms of the keto groups. Additionally, the compound may participate in various chemical reactions typical of amino acids, such as peptide bond formation. Its specific applications and reactivity would depend on the context of its use, particularly in medicinal chemistry or as a biochemical reagent. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C5H6N2O4
InChI:InChI=1/C5H6N2O4/c8-3-1-7(2-4(9)10)5(11)6-3/h1-2H2,(H,9,10)(H,6,8,11)
SMILES:C1C(=NC(=O)N1CC(=O)O)O
Synonyms:- 1-Imidazolidineacetic Acid, 2,4-Dioxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
