
CAS 947401-27-6
:N5-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N2-[(2-propen-1-yloxy)carbonyl]-L-ornithine
Description:
N5-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N2-[(2-propen-1-yloxy)carbonyl]-L-ornithine, with CAS number 947401-27-6, is a synthetic amino acid derivative that features a complex structure incorporating protective groups commonly used in peptide synthesis. The fluorenylmethoxycarbonyl (Fmoc) group is a widely utilized protecting group for amines, allowing for selective deprotection during peptide assembly. The presence of the propenyloxycarbonyl moiety suggests potential reactivity, which may facilitate further chemical modifications or coupling reactions. This compound is likely to be soluble in organic solvents, given the hydrophobic nature of the fluorenyl group, while the ornithine backbone contributes to its polar characteristics. Its design indicates applications in peptide synthesis, particularly in the development of bioactive peptides or pharmaceuticals. The compound's stability, reactivity, and solubility are essential for its utility in various chemical and biological contexts, including drug development and biochemical research. As with many synthetic compounds, handling should be conducted with care, adhering to safety protocols to mitigate any potential hazards.
Formula:C24H26N2O6
InChI:InChI=1S/C24H26N2O6/c1-2-14-31-24(30)26-21(22(27)28)12-7-13-25-23(29)32-15-20-18-10-5-3-8-16(18)17-9-4-6-11-19(17)20/h2-6,8-11,20-21H,1,7,12-15H2,(H,25,29)(H,26,30)(H,27,28)/t21-/m0/s1
InChI key:InChIKey=KFSBEJCNHHQQBT-NRFANRHFSA-N
SMILES:C(OC(NCCC[C@H](NC(OCC=C)=O)C(O)=O)=O)C1C=2C(C=3C1=CC=CC3)=CC=CC2
Synonyms:- N5-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N2-[(2-propen-1-yloxy)carbonyl]-L-ornithine
- 4: PN: WO2007096662 PAGE: 23 claimed protein
- L-Ornithine, N5-[(9H-fluoren-9-ylmethoxy)carbonyl]-N2-[(2-propen-1-yloxy)carbonyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.