CAS 947412-99-9

Methyl 3-(methoxymethyl)-1H-indole-5-carboxylate

Description:

Methyl 3-(methoxymethyl)-1H-indole-5-carboxylate is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a carboxylate ester functional group, indicated by the presence of the methyl ester, which contributes to its reactivity and solubility properties. The methoxymethyl substituent enhances its molecular complexity and may influence its biological activity. Typically, compounds like this are of interest in medicinal chemistry due to their potential pharmacological properties, including anti-inflammatory or anticancer activities. The presence of the indole moiety is often associated with various biological functions, making such compounds valuable in drug development. Additionally, the compound's solubility in organic solvents and stability under standard laboratory conditions are important characteristics for its handling and application in research. As with many organic compounds, safety data should be consulted to ensure proper handling and usage in laboratory settings.

Formula: C₁₂H₁₃NO₃

InChI: InChI=1S/C12H13NO3/c1-15-7-9-6-13-11-4-3-8(5-10(9)11)12(14)16-2/h3-6,13H,7H2,1-2H3

InChI key: InChIKey=WAYXZKMZVNUFGR-UHFFFAOYSA-N

SMILES: C(OC)C=1C=2C(NC1)=CC=C(C(OC)=O)C2

Synonyms:

• 1H-Indole-5-carboxylic acid, 3-(methoxymethyl)-, methyl ester
• Methyl 3-(methoxymethyl)-1H-indole-5-carboxylate

Methyl 3-(methoxymethyl)-1H-indole-5-carboxylate

CAS: 947412-99-9

Versatile small molecule scaffold

Formula: C₁₂H₁₃NO₃

Purity: Min. 95%

Molecular weight: 219.24 g/mol

Ref: 3D-XMB41299