CAS 947498-81-9

tert-Butyl 4-(1H-indazol-3-yl)piperazine-1-carboxylate

Description:

Tert-Butyl 4-(1H-indazol-3-yl)piperazine-1-carboxylate is a chemical compound characterized by its complex structure, which includes a tert-butyl group, a piperazine ring, and an indazole moiety. This compound typically exhibits properties associated with both piperazine derivatives and indazole-based structures, such as potential biological activity and solubility in organic solvents. The presence of the tert-butyl group enhances lipophilicity, which can influence its pharmacokinetic properties. The indazole ring may contribute to its interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the carboxylate functional group can participate in various chemical reactions, including esterification and amidation. The compound's molecular weight, melting point, and solubility characteristics would depend on its specific structural features and purity. Overall, tert-Butyl 4-(1H-indazol-3-yl)piperazine-1-carboxylate is a compound of interest for research in drug development and synthetic chemistry, particularly in the context of exploring its potential therapeutic applications.

Formula: C₁₆H₂₂N₄O₂

InChI: InChI=1/C16H22N4O2/c1-16(2,3)22-15(21)20-10-8-19(9-11-20)14-12-6-4-5-7-13(12)17-18-14/h4-7H,8-11H2,1-3H3,(H,17,18)

SMILES: CC(C)(C)OC(=O)N1CCN(CC1)c1c2ccccc2[nH]n1