CymitQuimica logo

CAS 947498-87-5

:

tert-Butyl 4-(1H-indol-3-yl)piperazine-1-carboxylate

Description:
Tert-Butyl 4-(1H-indol-3-yl)piperazine-1-carboxylate is a chemical compound characterized by its complex structure, which includes a tert-butyl group, an indole moiety, and a piperazine ring. This compound typically exhibits properties associated with both the indole and piperazine functionalities, such as potential biological activity and solubility in organic solvents. The presence of the tert-butyl group enhances its lipophilicity, which may influence its pharmacokinetic properties. The indole structure is known for its role in various biological systems and can contribute to the compound's interaction with biological targets. Additionally, the piperazine ring is often associated with psychoactive properties and can serve as a scaffold for drug development. The compound may be utilized in medicinal chemistry for the synthesis of novel therapeutic agents, particularly in the fields of neuroscience and oncology. Its specific reactivity and stability would depend on the conditions of use, including pH and temperature, as well as the presence of other reactive species.
Formula:C17H23N3O2
InChI:InChI=1/C17H23N3O2/c1-17(2,3)22-16(21)20-10-8-19(9-11-20)15-12-18-14-7-5-4-6-13(14)15/h4-7,12,18H,8-11H2,1-3H3
SMILES:CC(C)(C)OC(=O)N1CCN(CC1)c1c[nH]c2ccccc12
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.