CymitQuimica logo

CAS 947499-04-9

:

1,2,3,4-Tetrahydro-2-oxo-7-quinolinesulfonyl chloride

Description:
1,2,3,4-Tetrahydro-2-oxo-7-quinolinesulfonyl chloride is a chemical compound characterized by its unique structure, which includes a quinoline ring system fused with a tetrahydro group and a sulfonyl chloride functional group. This compound typically appears as a solid or crystalline substance and is known for its reactivity due to the presence of the sulfonyl chloride moiety, which can participate in various nucleophilic substitution reactions. It is often utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to act as a sulfonylating agent. The presence of the carbonyl group contributes to its electrophilic nature, making it a valuable intermediate in the synthesis of more complex molecules. Additionally, the compound may exhibit specific solubility characteristics depending on the solvent used, and its stability can be influenced by environmental factors such as moisture and temperature. Proper handling and storage are essential due to its reactive nature and potential hazards associated with sulfonyl chlorides.
Formula:C9H8ClNO3S
InChI:InChI=1S/C9H8ClNO3S/c10-15(13,14)7-3-1-6-2-4-9(12)11-8(6)5-7/h1,3,5H,2,4H2,(H,11,12)
InChI key:InChIKey=AAXOGFHTBCUHOE-UHFFFAOYSA-N
SMILES:S(Cl)(=O)(=O)C=1C=C2C(=CC1)CCC(=O)N2
Synonyms:
  • 2-Oxo-1,2,3,4-tetrahydroquinoline-7-sulfonyl chloride
  • 7-Quinolinesulfonyl chloride, 1,2,3,4-tetrahydro-2-oxo-
  • 1,2,3,4-Tetrahydro-2-oxo-7-quinolinesulfonyl chloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.